C14H13Br2N3O3S — CID 136919706
ethyl 2-[(2Z)-2-[(3,5-dibromo-4-hydroxyphenyl)methylidene]hydrazinyl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 136919706) has the molecular formula C14H13Br2N3O3S and a molecular weight of 463.15 g/mol. Its IUPAC name is ethyl 2-[(2Z)-2-[(3,5-dibromo-4-hydroxyphenyl)methylidene]hydrazinyl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[(2Z)-2-[(3,5-dibromo-4-hydroxyphenyl)methylidene]hydrazinyl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 136919706 |
| Molecular Formula | C14H13Br2N3O3S |
| Molecular Weight | 463.15 g/mol |
| Exact Mass | 460.90 |
| IUPAC Name | ethyl 2-[(2Z)-2-[(3,5-dibromo-4-hydroxyphenyl)methylidene]hydrazinyl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(N/N=C\c2cc(Br)c(O)c(Br)c2)nc1C |
| InChI | InChI=1S/C14H13Br2N3O3S/c1-3-22-13(21)12-7(2)18-14(23-12)19-17-6-8-4-9(15)11(20)10(16)5-8/h4-6,20H,3H2,1-2H3,(H,18,19)/b17-6- |
| InChIKey | OBIZIVMPEIPGAU-FMQZQXMHSA-N |
| XLogP | 4.30 |
| TPSA | 83.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.15 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|