C17H21N3O3S — CID 27275305
ethyl 4-methyl-2-[(2Z)-2-[(3-propoxyphenyl)methylidene]hydrazinyl]-1,3-thiazole-5-carboxylate (PubChem CID 27275305) has the molecular formula C17H21N3O3S and a molecular weight of 347.44 g/mol. Its IUPAC name is ethyl 4-methyl-2-[(2Z)-2-[(3-propoxyphenyl)methylidene]hydrazinyl]-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 4-methyl-2-[(2Z)-2-[(3-propoxyphenyl)methylidene]hydrazinyl]-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 27275305 |
| Molecular Formula | C17H21N3O3S |
| Molecular Weight | 347.44 g/mol |
| Exact Mass | 347.13 |
| IUPAC Name | ethyl 4-methyl-2-[(2Z)-2-[(3-propoxyphenyl)methylidene]hydrazinyl]-1,3-thiazole-5-carboxylate |
| SMILES | CCCOc1cccc(/C=N\Nc2nc(C)c(C(=O)OCC)s2)c1 |
| InChI | InChI=1S/C17H21N3O3S/c1-4-9-23-14-8-6-7-13(10-14)11-18-20-17-19-12(3)15(24-17)16(21)22-5-2/h6-8,10-11H,4-5,9H2,1-3H3,(H,19,20)/b18-11- |
| InChIKey | HPDVYUCDKCSADK-WQRHYEAKSA-N |
| XLogP | 3.86 |
| TPSA | 72.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.44 |
| LogP ≤ 5 | 3.86 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|