C14H19N3O2S — CID 729207
ethyl 2-[2-[[(1S)-cyclohex-3-en-1-yl]methylidene]hydrazinyl]-4-methyl-1,3-thiazole-5-carboxylate (PubChem CID 729207) has the molecular formula C14H19N3O2S and a molecular weight of 293.39 g/mol. Its IUPAC name is ethyl 2-[2-[[(1S)-cyclohex-3-en-1-yl]methylidene]hydrazinyl]-4-methyl-1,3-thiazole-5-carboxylate.
| Compound Name | ethyl 2-[2-[[(1S)-cyclohex-3-en-1-yl]methylidene]hydrazinyl]-4-methyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 729207 |
| Molecular Formula | C14H19N3O2S |
| Molecular Weight | 293.39 g/mol |
| Exact Mass | 293.12 |
| IUPAC Name | ethyl 2-[2-[[(1S)-cyclohex-3-en-1-yl]methylidene]hydrazinyl]-4-methyl-1,3-thiazole-5-carboxylate |
| SMILES | CCOC(=O)c1sc(NN=C[C@@H]2CC=CCC2)nc1C |
| InChI | InChI=1S/C14H19N3O2S/c1-3-19-13(18)12-10(2)16-14(20-12)17-15-9-11-7-5-4-6-8-11/h4-5,9,11H,3,6-8H2,1-2H3,(H,16,17)/t11-/m1/s1 |
| InChIKey | PIHVLXPTAZLJNE-LLVKDONJSA-N |
| XLogP | 3.38 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.39 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|