C18H14BrN3O2S — CID 110531487
methyl 2-[(2Z)-2-[(2-bromophenyl)methylidene]hydrazinyl]-4-phenyl-1,3-thiazole-5-carboxylate (PubChem CID 110531487) has the molecular formula C18H14BrN3O2S and a molecular weight of 416.30 g/mol. Its IUPAC name is methyl 2-[(2Z)-2-[(2-bromophenyl)methylidene]hydrazinyl]-4-phenyl-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 2-[(2Z)-2-[(2-bromophenyl)methylidene]hydrazinyl]-4-phenyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 110531487 |
| Molecular Formula | C18H14BrN3O2S |
| Molecular Weight | 416.30 g/mol |
| Exact Mass | 415.00 |
| IUPAC Name | methyl 2-[(2Z)-2-[(2-bromophenyl)methylidene]hydrazinyl]-4-phenyl-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1sc(N/N=C\c2ccccc2Br)nc1-c1ccccc1 |
| InChI | InChI=1S/C18H14BrN3O2S/c1-24-17(23)16-15(12-7-3-2-4-8-12)21-18(25-16)22-20-11-13-9-5-6-10-14(13)19/h2-11H,1H3,(H,21,22)/b20-11- |
| InChIKey | ZULJDERQASQGNL-JAIQZWGSSA-N |
| XLogP | 4.81 |
| TPSA | 63.58 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 416.30 |
| LogP ≤ 5 | 4.81 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|