C19H16N4O6S — CID 136781617
methyl 2-[(2Z)-2-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylidene]hydrazinyl]-4-phenyl-1,3-thiazole-5-carboxylate (PubChem CID 136781617) has the molecular formula C19H16N4O6S and a molecular weight of 428.43 g/mol. Its IUPAC name is methyl 2-[(2Z)-2-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylidene]hydrazinyl]-4-phenyl-1,3-thiazole-5-carboxylate.
| Compound Name | methyl 2-[(2Z)-2-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylidene]hydrazinyl]-4-phenyl-1,3-thiazole-5-carboxylate |
|---|---|
| PubChem CID | 136781617 |
| Molecular Formula | C19H16N4O6S |
| Molecular Weight | 428.43 g/mol |
| Exact Mass | 428.08 |
| IUPAC Name | methyl 2-[(2Z)-2-[(4-hydroxy-3-methoxy-5-nitrophenyl)methylidene]hydrazinyl]-4-phenyl-1,3-thiazole-5-carboxylate |
| SMILES | COC(=O)c1sc(N/N=C\c2cc(OC)c(O)c([N+](=O)[O-])c2)nc1-c1ccccc1 |
| InChI | InChI=1S/C19H16N4O6S/c1-28-14-9-11(8-13(16(14)24)23(26)27)10-20-22-19-21-15(12-6-4-3-5-7-12)17(30-19)18(25)29-2/h3-10,24H,1-2H3,(H,21,22)/b20-10- |
| InChIKey | SUZPBWFWEWDCDN-JMIUGGIZSA-N |
| XLogP | 3.67 |
| TPSA | 136.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.43 |
| LogP ≤ 5 | 3.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|