C19H17ClN4OS — CID 3722954
N-[2-[2-[(3-chlorophenyl)methylidene]hydrazinyl]-4-(4-methylphenyl)-1,3-thiazol-5-yl]acetamide (PubChem CID 3722954) has the molecular formula C19H17ClN4OS and a molecular weight of 384.89 g/mol. Its IUPAC name is N-[2-[2-[(3-chlorophenyl)methylidene]hydrazinyl]-4-(4-methylphenyl)-1,3-thiazol-5-yl]acetamide.
| Compound Name | N-[2-[2-[(3-chlorophenyl)methylidene]hydrazinyl]-4-(4-methylphenyl)-1,3-thiazol-5-yl]acetamide |
|---|---|
| PubChem CID | 3722954 |
| Molecular Formula | C19H17ClN4OS |
| Molecular Weight | 384.89 g/mol |
| Exact Mass | 384.08 |
| IUPAC Name | N-[2-[2-[(3-chlorophenyl)methylidene]hydrazinyl]-4-(4-methylphenyl)-1,3-thiazol-5-yl]acetamide |
| SMILES | CC(=O)Nc1sc(NN=Cc2cccc(Cl)c2)nc1-c1ccc(C)cc1 |
| InChI | InChI=1S/C19H17ClN4OS/c1-12-6-8-15(9-7-12)17-18(22-13(2)25)26-19(23-17)24-21-11-14-4-3-5-16(20)10-14/h3-11H,1-2H3,(H,22,25)(H,23,24) |
| InChIKey | CHFQEMZTNAZKJV-UHFFFAOYSA-N |
| XLogP | 5.18 |
| TPSA | 66.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.89 |
| LogP ≤ 5 | 5.18 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|