C21H15Cl2N5O2 — CID 171981138
2-N,6-N-bis[(E)-(3-chlorophenyl)methylideneamino]pyridine-2,6-dicarboxamide (PubChem CID 171981138) has the molecular formula C21H15Cl2N5O2 and a molecular weight of 440.29 g/mol. Its IUPAC name is 2-N,6-N-bis[(E)-(3-chlorophenyl)methylideneamino]pyridine-2,6-dicarboxamide.
| Compound Name | 2-N,6-N-bis[(E)-(3-chlorophenyl)methylideneamino]pyridine-2,6-dicarboxamide |
|---|---|
| PubChem CID | 171981138 |
| Molecular Formula | C21H15Cl2N5O2 |
| Molecular Weight | 440.29 g/mol |
| Exact Mass | 439.06 |
| IUPAC Name | 2-N,6-N-bis[(E)-(3-chlorophenyl)methylideneamino]pyridine-2,6-dicarboxamide |
| SMILES | O=C(N/N=C/c1cccc(Cl)c1)c1cccc(C(=O)N/N=C/c2cccc(Cl)c2)n1 |
| InChI | InChI=1S/C21H15Cl2N5O2/c22-16-6-1-4-14(10-16)12-24-27-20(29)18-8-3-9-19(26-18)21(30)28-25-13-15-5-2-7-17(23)11-15/h1-13H,(H,27,29)(H,28,30)/b24-12+,25-13+ |
| InChIKey | CTAMKOUTARRURK-DWGHPKEWSA-N |
| XLogP | 3.92 |
| TPSA | 95.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 440.29 |
| LogP ≤ 5 | 3.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|