C15H13N3OS2 — CID 136822239
4-[(Z)-[(5-methyl-4-thiophen-2-yl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenol (PubChem CID 136822239) has the molecular formula C15H13N3OS2 and a molecular weight of 315.42 g/mol. Its IUPAC name is 4-[(Z)-[(5-methyl-4-thiophen-2-yl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenol.
| Compound Name | 4-[(Z)-[(5-methyl-4-thiophen-2-yl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenol |
|---|---|
| PubChem CID | 136822239 |
| Molecular Formula | C15H13N3OS2 |
| Molecular Weight | 315.42 g/mol |
| Exact Mass | 315.05 |
| IUPAC Name | 4-[(Z)-[(5-methyl-4-thiophen-2-yl-1,3-thiazol-2-yl)hydrazinylidene]methyl]phenol |
| SMILES | Cc1sc(N/N=C\c2ccc(O)cc2)nc1-c1cccs1 |
| InChI | InChI=1S/C15H13N3OS2/c1-10-14(13-3-2-8-20-13)17-15(21-10)18-16-9-11-4-6-12(19)7-5-11/h2-9,19H,1H3,(H,17,18)/b16-9- |
| InChIKey | FYZMXZBRHSJLKK-SXGWCWSVSA-N |
| XLogP | 4.33 |
| TPSA | 57.51 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.42 |
| LogP ≤ 5 | 4.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|