C32H23N3O4S — CID 6128655
ethyl 4-[5-[(E)-2-(5-benzamido-4-phenyl-1,3-thiazol-2-yl)-2-cyanoethenyl]furan-2-yl]benzoate (PubChem CID 6128655) has the molecular formula C32H23N3O4S and a molecular weight of 545.62 g/mol. Its IUPAC name is ethyl 4-[5-[(E)-2-(5-benzamido-4-phenyl-1,3-thiazol-2-yl)-2-cyanoethenyl]furan-2-yl]benzoate.
| Compound Name | ethyl 4-[5-[(E)-2-(5-benzamido-4-phenyl-1,3-thiazol-2-yl)-2-cyanoethenyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 6128655 |
| Molecular Formula | C32H23N3O4S |
| Molecular Weight | 545.62 g/mol |
| Exact Mass | 545.14 |
| IUPAC Name | ethyl 4-[5-[(E)-2-(5-benzamido-4-phenyl-1,3-thiazol-2-yl)-2-cyanoethenyl]furan-2-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2ccc(/C=C(\C#N)c3nc(-c4ccccc4)c(NC(=O)c4ccccc4)s3)o2)cc1 |
| InChI | InChI=1S/C32H23N3O4S/c1-2-38-32(37)24-15-13-21(14-16-24)27-18-17-26(39-27)19-25(20-33)30-34-28(22-9-5-3-6-10-22)31(40-30)35-29(36)23-11-7-4-8-12-23/h3-19H,2H2,1H3,(H,35,36)/b25-19+ |
| InChIKey | KVWQSXYYVAUNFB-NCELDCMTSA-N |
| XLogP | 7.56 |
| TPSA | 105.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 545.62 |
| LogP ≤ 5 | 7.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|