C22H17NO3 — CID 126365236
ethyl 4-[5-[(E)-2-cyano-2-phenylethenyl]furan-2-yl]benzoate (PubChem CID 126365236) has the molecular formula C22H17NO3 and a molecular weight of 343.38 g/mol. Its IUPAC name is ethyl 4-[5-[(E)-2-cyano-2-phenylethenyl]furan-2-yl]benzoate.
| Compound Name | ethyl 4-[5-[(E)-2-cyano-2-phenylethenyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 126365236 |
| Molecular Formula | C22H17NO3 |
| Molecular Weight | 343.38 g/mol |
| Exact Mass | 343.12 |
| IUPAC Name | ethyl 4-[5-[(E)-2-cyano-2-phenylethenyl]furan-2-yl]benzoate |
| SMILES | CCOC(=O)c1ccc(-c2ccc(/C=C(/C#N)c3ccccc3)o2)cc1 |
| InChI | InChI=1S/C22H17NO3/c1-2-25-22(24)18-10-8-17(9-11-18)21-13-12-20(26-21)14-19(15-23)16-6-4-3-5-7-16/h3-14H,2H2,1H3/b19-14- |
| InChIKey | DIUAYIQHNLORCS-RGEXLXHISA-N |
| XLogP | 5.19 |
| TPSA | 63.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 343.38 |
| LogP ≤ 5 | 5.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|