C22H14N2O3S2 — CID 6046239
methyl 4-[5-[(E)-2-(1,3-benzothiazol-2-ylsulfanyl)-2-cyanoethenyl]furan-2-yl]benzoate (PubChem CID 6046239) has the molecular formula C22H14N2O3S2 and a molecular weight of 418.50 g/mol. Its IUPAC name is methyl 4-[5-[(E)-2-(1,3-benzothiazol-2-ylsulfanyl)-2-cyanoethenyl]furan-2-yl]benzoate.
| Compound Name | methyl 4-[5-[(E)-2-(1,3-benzothiazol-2-ylsulfanyl)-2-cyanoethenyl]furan-2-yl]benzoate |
|---|---|
| PubChem CID | 6046239 |
| Molecular Formula | C22H14N2O3S2 |
| Molecular Weight | 418.50 g/mol |
| Exact Mass | 418.04 |
| IUPAC Name | methyl 4-[5-[(E)-2-(1,3-benzothiazol-2-ylsulfanyl)-2-cyanoethenyl]furan-2-yl]benzoate |
| SMILES | COC(=O)c1ccc(-c2ccc(/C=C(\C#N)Sc3nc4ccccc4s3)o2)cc1 |
| InChI | InChI=1S/C22H14N2O3S2/c1-26-21(25)15-8-6-14(7-9-15)19-11-10-16(27-19)12-17(13-23)28-22-24-18-4-2-3-5-20(18)29-22/h2-12H,1H3/b17-12+ |
| InChIKey | LJINLIJOYOJFHC-SFQUDFHCSA-N |
| XLogP | 6.00 |
| TPSA | 76.12 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.50 |
| LogP ≤ 5 | 6.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|