C20H11N3O3S2 — CID 4040162
2-(1,3-benzothiazol-2-ylsulfanyl)-3-[5-(4-nitrophenyl)furan-2-yl]prop-2-enenitrile (PubChem CID 4040162) has the molecular formula C20H11N3O3S2 and a molecular weight of 405.46 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylsulfanyl)-3-[5-(4-nitrophenyl)furan-2-yl]prop-2-enenitrile.
| Compound Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-3-[5-(4-nitrophenyl)furan-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 4040162 |
| Molecular Formula | C20H11N3O3S2 |
| Molecular Weight | 405.46 g/mol |
| Exact Mass | 405.02 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-3-[5-(4-nitrophenyl)furan-2-yl]prop-2-enenitrile |
| SMILES | N#CC(=Cc1ccc(-c2ccc([N+](=O)[O-])cc2)o1)Sc1nc2ccccc2s1 |
| InChI | InChI=1S/C20H11N3O3S2/c21-12-16(27-20-22-17-3-1-2-4-19(17)28-20)11-15-9-10-18(26-15)13-5-7-14(8-6-13)23(24)25/h1-11H |
| InChIKey | LFAHHUPHYTXAAY-UHFFFAOYSA-N |
| XLogP | 6.12 |
| TPSA | 92.96 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.46 |
| LogP ≤ 5 | 6.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|