C23H13I2N3O3S2 — CID 126388557
(E)-2-(1,3-benzothiazol-2-ylsulfanyl)-3-[3,5-diiodo-4-[(4-nitrophenyl)methoxy]phenyl]prop-2-enenitrile (PubChem CID 126388557) has the molecular formula C23H13I2N3O3S2 and a molecular weight of 697.32 g/mol. Its IUPAC name is (E)-2-(1,3-benzothiazol-2-ylsulfanyl)-3-[3,5-diiodo-4-[(4-nitrophenyl)methoxy]phenyl]prop-2-enenitrile.
| Compound Name | (E)-2-(1,3-benzothiazol-2-ylsulfanyl)-3-[3,5-diiodo-4-[(4-nitrophenyl)methoxy]phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 126388557 |
| Molecular Formula | C23H13I2N3O3S2 |
| Molecular Weight | 697.32 g/mol |
| Exact Mass | 696.85 |
| IUPAC Name | (E)-2-(1,3-benzothiazol-2-ylsulfanyl)-3-[3,5-diiodo-4-[(4-nitrophenyl)methoxy]phenyl]prop-2-enenitrile |
| SMILES | N#C/C(=C\c1cc(I)c(OCc2ccc([N+](=O)[O-])cc2)c(I)c1)Sc1nc2ccccc2s1 |
| InChI | InChI=1S/C23H13I2N3O3S2/c24-18-10-15(9-17(12-26)32-23-27-20-3-1-2-4-21(20)33-23)11-19(25)22(18)31-13-14-5-7-16(8-6-14)28(29)30/h1-11H,13H2/b17-9+ |
| InChIKey | UAWAYGQXMKGSEE-RQZCQDPDSA-N |
| XLogP | 7.65 |
| TPSA | 89.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 697.32 |
| LogP ≤ 5 | 7.65 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|