C18H13N3O4S2 — CID 2224318
(E)-2-(1,3-benzothiazol-2-ylsulfanyl)-3-(4,5-dimethoxy-2-nitrophenyl)prop-2-enenitrile (PubChem CID 2224318) has the molecular formula C18H13N3O4S2 and a molecular weight of 399.45 g/mol. Its IUPAC name is (E)-2-(1,3-benzothiazol-2-ylsulfanyl)-3-(4,5-dimethoxy-2-nitrophenyl)prop-2-enenitrile.
| Compound Name | (E)-2-(1,3-benzothiazol-2-ylsulfanyl)-3-(4,5-dimethoxy-2-nitrophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 2224318 |
| Molecular Formula | C18H13N3O4S2 |
| Molecular Weight | 399.45 g/mol |
| Exact Mass | 399.03 |
| IUPAC Name | (E)-2-(1,3-benzothiazol-2-ylsulfanyl)-3-(4,5-dimethoxy-2-nitrophenyl)prop-2-enenitrile |
| SMILES | COc1cc(/C=C(\C#N)Sc2nc3ccccc3s2)c([N+](=O)[O-])cc1OC |
| InChI | InChI=1S/C18H13N3O4S2/c1-24-15-8-11(14(21(22)23)9-16(15)25-2)7-12(10-19)26-18-20-13-5-3-4-6-17(13)27-18/h3-9H,1-2H3/b12-7+ |
| InChIKey | MLTBQQKLDQOMMS-KPKJPENVSA-N |
| XLogP | 4.88 |
| TPSA | 98.28 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.45 |
| LogP ≤ 5 | 4.88 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|