C17H11N3O2S2 — CID 3630996
2-(1,3-benzothiazol-2-ylsulfanyl)-3-(4-methyl-3-nitrophenyl)prop-2-enenitrile (PubChem CID 3630996) has the molecular formula C17H11N3O2S2 and a molecular weight of 353.43 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylsulfanyl)-3-(4-methyl-3-nitrophenyl)prop-2-enenitrile.
| Compound Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-3-(4-methyl-3-nitrophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 3630996 |
| Molecular Formula | C17H11N3O2S2 |
| Molecular Weight | 353.43 g/mol |
| Exact Mass | 353.03 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-3-(4-methyl-3-nitrophenyl)prop-2-enenitrile |
| SMILES | Cc1ccc(C=C(C#N)Sc2nc3ccccc3s2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H11N3O2S2/c1-11-6-7-12(9-15(11)20(21)22)8-13(10-18)23-17-19-14-4-2-3-5-16(14)24-17/h2-9H,1H3 |
| InChIKey | OWMXPMIMMCDFTF-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 79.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.43 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|