C15H10N2OS2 — CID 2984361
2-(1,3-benzothiazol-2-ylsulfanyl)-3-(5-methylfuran-2-yl)prop-2-enenitrile (PubChem CID 2984361) has the molecular formula C15H10N2OS2 and a molecular weight of 298.39 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylsulfanyl)-3-(5-methylfuran-2-yl)prop-2-enenitrile.
| Compound Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-3-(5-methylfuran-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 2984361 |
| Molecular Formula | C15H10N2OS2 |
| Molecular Weight | 298.39 g/mol |
| Exact Mass | 298.02 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-3-(5-methylfuran-2-yl)prop-2-enenitrile |
| SMILES | Cc1ccc(C=C(C#N)Sc2nc3ccccc3s2)o1 |
| InChI | InChI=1S/C15H10N2OS2/c1-10-6-7-11(18-10)8-12(9-16)19-15-17-13-4-2-3-5-14(13)20-15/h2-8H,1H3 |
| InChIKey | UTSGAVKSEFFVSY-UHFFFAOYSA-N |
| XLogP | 4.85 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.39 |
| LogP ≤ 5 | 4.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|