C16H9BrN2S2 — CID 4222238
2-(1,3-benzothiazol-2-ylsulfanyl)-3-(4-bromophenyl)prop-2-enenitrile (PubChem CID 4222238) has the molecular formula C16H9BrN2S2 and a molecular weight of 373.30 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylsulfanyl)-3-(4-bromophenyl)prop-2-enenitrile.
| Compound Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-3-(4-bromophenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 4222238 |
| Molecular Formula | C16H9BrN2S2 |
| Molecular Weight | 373.30 g/mol |
| Exact Mass | 371.94 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-3-(4-bromophenyl)prop-2-enenitrile |
| SMILES | N#CC(=Cc1ccc(Br)cc1)Sc1nc2ccccc2s1 |
| InChI | InChI=1S/C16H9BrN2S2/c17-12-7-5-11(6-8-12)9-13(10-18)20-16-19-14-3-1-2-4-15(14)21-16/h1-9H |
| InChIKey | KDLQLOCJPJPPPO-UHFFFAOYSA-N |
| XLogP | 5.72 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.30 |
| LogP ≤ 5 | 5.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|