C17H12N2O2S2 — CID 4216154
2-(1,3-benzothiazol-2-ylsulfanyl)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enenitrile (PubChem CID 4216154) has the molecular formula C17H12N2O2S2 and a molecular weight of 340.43 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylsulfanyl)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enenitrile.
| Compound Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 4216154 |
| Molecular Formula | C17H12N2O2S2 |
| Molecular Weight | 340.43 g/mol |
| Exact Mass | 340.03 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-3-(4-hydroxy-3-methoxyphenyl)prop-2-enenitrile |
| SMILES | COc1cc(C=C(C#N)Sc2nc3ccccc3s2)ccc1O |
| InChI | InChI=1S/C17H12N2O2S2/c1-21-15-9-11(6-7-14(15)20)8-12(10-18)22-17-19-13-4-2-3-5-16(13)23-17/h2-9,20H,1H3 |
| InChIKey | CAWMDBNSYQNWIM-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 66.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.43 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|