C25H19ClN2O2S2 — CID 5029166
2-(1,3-benzothiazol-2-ylsulfanyl)-3-[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]prop-2-enenitrile (PubChem CID 5029166) has the molecular formula C25H19ClN2O2S2 and a molecular weight of 479.03 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylsulfanyl)-3-[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]prop-2-enenitrile.
| Compound Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-3-[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 5029166 |
| Molecular Formula | C25H19ClN2O2S2 |
| Molecular Weight | 479.03 g/mol |
| Exact Mass | 478.06 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-3-[4-[(4-chlorophenyl)methoxy]-3-ethoxyphenyl]prop-2-enenitrile |
| SMILES | CCOc1cc(C=C(C#N)Sc2nc3ccccc3s2)ccc1OCc1ccc(Cl)cc1 |
| InChI | InChI=1S/C25H19ClN2O2S2/c1-2-29-23-14-18(9-12-22(23)30-16-17-7-10-19(26)11-8-17)13-20(15-27)31-25-28-21-5-3-4-6-24(21)32-25/h3-14H,2,16H2,1H3 |
| InChIKey | SQZMYYUKTGDBSQ-UHFFFAOYSA-N |
| XLogP | 7.58 |
| TPSA | 55.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 479.03 |
| LogP ≤ 5 | 7.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|