C21H15ClN2O2S2 — CID 4033723
2-(1,3-benzothiazol-2-ylsulfanyl)-3-(3-chloro-5-ethoxy-4-prop-2-ynoxyphenyl)prop-2-enenitrile (PubChem CID 4033723) has the molecular formula C21H15ClN2O2S2 and a molecular weight of 426.95 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylsulfanyl)-3-(3-chloro-5-ethoxy-4-prop-2-ynoxyphenyl)prop-2-enenitrile.
| Compound Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-3-(3-chloro-5-ethoxy-4-prop-2-ynoxyphenyl)prop-2-enenitrile |
|---|---|
| PubChem CID | 4033723 |
| Molecular Formula | C21H15ClN2O2S2 |
| Molecular Weight | 426.95 g/mol |
| Exact Mass | 426.03 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-3-(3-chloro-5-ethoxy-4-prop-2-ynoxyphenyl)prop-2-enenitrile |
| SMILES | C#CCOc1c(Cl)cc(C=C(C#N)Sc2nc3ccccc3s2)cc1OCC |
| InChI | InChI=1S/C21H15ClN2O2S2/c1-3-9-26-20-16(22)11-14(12-18(20)25-4-2)10-15(13-23)27-21-24-17-7-5-6-8-19(17)28-21/h1,5-8,10-12H,4,9H2,2H3 |
| InChIKey | FTRBJCJJLAWQLL-UHFFFAOYSA-N |
| XLogP | 6.02 |
| TPSA | 55.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.95 |
| LogP ≤ 5 | 6.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|