C27H16I2N2OS2 — CID 126388587
(E)-2-(1,3-benzothiazol-2-ylsulfanyl)-3-[3,5-diiodo-4-(naphthalen-1-ylmethoxy)phenyl]prop-2-enenitrile (PubChem CID 126388587) has the molecular formula C27H16I2N2OS2 and a molecular weight of 702.38 g/mol. Its IUPAC name is (E)-2-(1,3-benzothiazol-2-ylsulfanyl)-3-[3,5-diiodo-4-(naphthalen-1-ylmethoxy)phenyl]prop-2-enenitrile.
| Compound Name | (E)-2-(1,3-benzothiazol-2-ylsulfanyl)-3-[3,5-diiodo-4-(naphthalen-1-ylmethoxy)phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 126388587 |
| Molecular Formula | C27H16I2N2OS2 |
| Molecular Weight | 702.38 g/mol |
| Exact Mass | 701.88 |
| IUPAC Name | (E)-2-(1,3-benzothiazol-2-ylsulfanyl)-3-[3,5-diiodo-4-(naphthalen-1-ylmethoxy)phenyl]prop-2-enenitrile |
| SMILES | N#C/C(=C\c1cc(I)c(OCc2cccc3ccccc23)c(I)c1)Sc1nc2ccccc2s1 |
| InChI | InChI=1S/C27H16I2N2OS2/c28-22-13-17(12-20(15-30)33-27-31-24-10-3-4-11-25(24)34-27)14-23(29)26(22)32-16-19-8-5-7-18-6-1-2-9-21(18)19/h1-14H,16H2/b20-12+ |
| InChIKey | VUMLZWNFNYBNJK-UDWIEESQSA-N |
| XLogP | 8.89 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 702.38 |
| LogP ≤ 5 | 8.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|