C18H11N3S2 — CID 1243315
(Z)-2-(1,3-benzothiazol-2-ylsulfanyl)-3-(1H-indol-3-yl)prop-2-enenitrile (PubChem CID 1243315) has the molecular formula C18H11N3S2 and a molecular weight of 333.44 g/mol. Its IUPAC name is (Z)-2-(1,3-benzothiazol-2-ylsulfanyl)-3-(1H-indol-3-yl)prop-2-enenitrile.
| Compound Name | (Z)-2-(1,3-benzothiazol-2-ylsulfanyl)-3-(1H-indol-3-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 1243315 |
| Molecular Formula | C18H11N3S2 |
| Molecular Weight | 333.44 g/mol |
| Exact Mass | 333.04 |
| IUPAC Name | (Z)-2-(1,3-benzothiazol-2-ylsulfanyl)-3-(1H-indol-3-yl)prop-2-enenitrile |
| SMILES | N#C/C(=C/c1c[nH]c2ccccc12)Sc1nc2ccccc2s1 |
| InChI | InChI=1S/C18H11N3S2/c19-10-13(9-12-11-20-15-6-2-1-5-14(12)15)22-18-21-16-7-3-4-8-17(16)23-18/h1-9,11,20H/b13-9- |
| InChIKey | AQERFYGXJUIEPK-LCYFTJDESA-N |
| XLogP | 5.43 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.44 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|