C9H4N2S3 — CID 14937961
1,3-benzothiazol-2-yl cyanomethanedithioate (PubChem CID 14937961) has the molecular formula C9H4N2S3 and a molecular weight of 236.35 g/mol. Its IUPAC name is 1,3-benzothiazol-2-yl cyanomethanedithioate.
| Compound Name | 1,3-benzothiazol-2-yl cyanomethanedithioate |
|---|---|
| PubChem CID | 14937961 |
| Molecular Formula | C9H4N2S3 |
| Molecular Weight | 236.35 g/mol |
| Exact Mass | 235.95 |
| IUPAC Name | 1,3-benzothiazol-2-yl cyanomethanedithioate |
| SMILES | N#CC(=S)Sc1nc2ccccc2s1 |
| InChI | InChI=1S/C9H4N2S3/c10-5-8(12)14-9-11-6-3-1-2-4-7(6)13-9/h1-4H |
| InChIKey | PFOBKTVWDMHBPL-UHFFFAOYSA-N |
| XLogP | 3.24 |
| TPSA | 36.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 236.35 |
| LogP ≤ 5 | 3.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|