C14H9N3S2 — CID 1266833
(E)-2-(1,3-benzothiazol-2-ylsulfanyl)-3-(1H-pyrrol-2-yl)prop-2-enenitrile (PubChem CID 1266833) has the molecular formula C14H9N3S2 and a molecular weight of 283.38 g/mol. Its IUPAC name is (E)-2-(1,3-benzothiazol-2-ylsulfanyl)-3-(1H-pyrrol-2-yl)prop-2-enenitrile.
| Compound Name | (E)-2-(1,3-benzothiazol-2-ylsulfanyl)-3-(1H-pyrrol-2-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 1266833 |
| Molecular Formula | C14H9N3S2 |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.02 |
| IUPAC Name | (E)-2-(1,3-benzothiazol-2-ylsulfanyl)-3-(1H-pyrrol-2-yl)prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccc[nH]1)Sc1nc2ccccc2s1 |
| InChI | InChI=1S/C14H9N3S2/c15-9-11(8-10-4-3-7-16-10)18-14-17-12-5-1-2-6-13(12)19-14/h1-8,16H/b11-8+ |
| InChIKey | JWLXWCKZQPZSPM-DHZHZOJOSA-N |
| XLogP | 4.28 |
| TPSA | 52.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|