C19H13N3S2 — CID 4988699
2-(1,3-benzothiazol-2-ylsulfanyl)-3-(1-methylindol-3-yl)prop-2-enenitrile (PubChem CID 4988699) has the molecular formula C19H13N3S2 and a molecular weight of 347.47 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylsulfanyl)-3-(1-methylindol-3-yl)prop-2-enenitrile.
| Compound Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-3-(1-methylindol-3-yl)prop-2-enenitrile |
|---|---|
| PubChem CID | 4988699 |
| Molecular Formula | C19H13N3S2 |
| Molecular Weight | 347.47 g/mol |
| Exact Mass | 347.06 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-3-(1-methylindol-3-yl)prop-2-enenitrile |
| SMILES | Cn1cc(C=C(C#N)Sc2nc3ccccc3s2)c2ccccc21 |
| InChI | InChI=1S/C19H13N3S2/c1-22-12-13(15-6-2-4-8-17(15)22)10-14(11-20)23-19-21-16-7-3-5-9-18(16)24-19/h2-10,12H,1H3 |
| InChIKey | NDNLRSVJNXYRDC-UHFFFAOYSA-N |
| XLogP | 5.44 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.47 |
| LogP ≤ 5 | 5.44 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|