C22H16ClN3S2 — CID 6305106
(E)-2-(1,3-benzothiazol-2-ylsulfanyl)-3-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enenitrile (PubChem CID 6305106) has the molecular formula C22H16ClN3S2 and a molecular weight of 421.98 g/mol. Its IUPAC name is (E)-2-(1,3-benzothiazol-2-ylsulfanyl)-3-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enenitrile.
| Compound Name | (E)-2-(1,3-benzothiazol-2-ylsulfanyl)-3-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 6305106 |
| Molecular Formula | C22H16ClN3S2 |
| Molecular Weight | 421.98 g/mol |
| Exact Mass | 421.05 |
| IUPAC Name | (E)-2-(1,3-benzothiazol-2-ylsulfanyl)-3-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]prop-2-enenitrile |
| SMILES | Cc1cc(/C=C(\C#N)Sc2nc3ccccc3s2)c(C)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C22H16ClN3S2/c1-14-11-16(15(2)26(14)18-9-7-17(23)8-10-18)12-19(13-24)27-22-25-20-5-3-4-6-21(20)28-22/h3-12H,1-2H3/b19-12+ |
| InChIKey | OMXDETZLMFKDKP-XDHOZWIPSA-N |
| XLogP | 7.01 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.98 |
| LogP ≤ 5 | 7.01 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|