C20H10Cl2N2OS2 — CID 3262712
2-(1,3-benzothiazol-2-ylsulfanyl)-3-[5-(2,4-dichlorophenyl)furan-2-yl]prop-2-enenitrile (PubChem CID 3262712) has the molecular formula C20H10Cl2N2OS2 and a molecular weight of 429.35 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylsulfanyl)-3-[5-(2,4-dichlorophenyl)furan-2-yl]prop-2-enenitrile.
| Compound Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-3-[5-(2,4-dichlorophenyl)furan-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 3262712 |
| Molecular Formula | C20H10Cl2N2OS2 |
| Molecular Weight | 429.35 g/mol |
| Exact Mass | 427.96 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-3-[5-(2,4-dichlorophenyl)furan-2-yl]prop-2-enenitrile |
| SMILES | N#CC(=Cc1ccc(-c2ccc(Cl)cc2Cl)o1)Sc1nc2ccccc2s1 |
| InChI | InChI=1S/C20H10Cl2N2OS2/c21-12-5-7-15(16(22)9-12)18-8-6-13(25-18)10-14(11-23)26-20-24-17-3-1-2-4-19(17)27-20/h1-10H |
| InChIKey | DKNCOCZOHQEUMT-UHFFFAOYSA-N |
| XLogP | 7.52 |
| TPSA | 49.82 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 429.35 |
| LogP ≤ 5 | 7.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|