C23H14Cl2N2OS2 — CID 3988736
2-(1,3-benzothiazol-2-ylsulfanyl)-3-[4-[(2,4-dichlorophenyl)methoxy]phenyl]prop-2-enenitrile (PubChem CID 3988736) has the molecular formula C23H14Cl2N2OS2 and a molecular weight of 469.42 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylsulfanyl)-3-[4-[(2,4-dichlorophenyl)methoxy]phenyl]prop-2-enenitrile.
| Compound Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-3-[4-[(2,4-dichlorophenyl)methoxy]phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 3988736 |
| Molecular Formula | C23H14Cl2N2OS2 |
| Molecular Weight | 469.42 g/mol |
| Exact Mass | 467.99 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-3-[4-[(2,4-dichlorophenyl)methoxy]phenyl]prop-2-enenitrile |
| SMILES | N#CC(=Cc1ccc(OCc2ccc(Cl)cc2Cl)cc1)Sc1nc2ccccc2s1 |
| InChI | InChI=1S/C23H14Cl2N2OS2/c24-17-8-7-16(20(25)12-17)14-28-18-9-5-15(6-10-18)11-19(13-26)29-23-27-21-3-1-2-4-22(21)30-23/h1-12H,14H2 |
| InChIKey | REKZWDZIISQBCZ-UHFFFAOYSA-N |
| XLogP | 7.84 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 469.42 |
| LogP ≤ 5 | 7.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|