C27H17BrN2OS2 — CID 126388384
(E)-2-(1,3-benzothiazol-2-ylsulfanyl)-3-[3-bromo-4-(naphthalen-1-ylmethoxy)phenyl]prop-2-enenitrile (PubChem CID 126388384) has the molecular formula C27H17BrN2OS2 and a molecular weight of 529.48 g/mol. Its IUPAC name is (E)-2-(1,3-benzothiazol-2-ylsulfanyl)-3-[3-bromo-4-(naphthalen-1-ylmethoxy)phenyl]prop-2-enenitrile.
| Compound Name | (E)-2-(1,3-benzothiazol-2-ylsulfanyl)-3-[3-bromo-4-(naphthalen-1-ylmethoxy)phenyl]prop-2-enenitrile |
|---|---|
| PubChem CID | 126388384 |
| Molecular Formula | C27H17BrN2OS2 |
| Molecular Weight | 529.48 g/mol |
| Exact Mass | 528.00 |
| IUPAC Name | (E)-2-(1,3-benzothiazol-2-ylsulfanyl)-3-[3-bromo-4-(naphthalen-1-ylmethoxy)phenyl]prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccc(OCc2cccc3ccccc23)c(Br)c1)Sc1nc2ccccc2s1 |
| InChI | InChI=1S/C27H17BrN2OS2/c28-23-15-18(14-21(16-29)32-27-30-24-10-3-4-11-26(24)33-27)12-13-25(23)31-17-20-8-5-7-19-6-1-2-9-22(19)20/h1-15H,17H2/b21-14+ |
| InChIKey | ITVSNYYAZNZDEZ-KGENOOAVSA-N |
| XLogP | 8.45 |
| TPSA | 45.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 529.48 |
| LogP ≤ 5 | 8.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|