C17H9Cl2NOS — CID 16649177
2-[5-(2,4-dichlorophenyl)furan-2-yl]-1,3-benzothiazole (PubChem CID 16649177) has the molecular formula C17H9Cl2NOS and a molecular weight of 346.24 g/mol. Its IUPAC name is 2-[5-(2,4-dichlorophenyl)furan-2-yl]-1,3-benzothiazole.
| Compound Name | 2-[5-(2,4-dichlorophenyl)furan-2-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 16649177 |
| Molecular Formula | C17H9Cl2NOS |
| Molecular Weight | 346.24 g/mol |
| Exact Mass | 344.98 |
| IUPAC Name | 2-[5-(2,4-dichlorophenyl)furan-2-yl]-1,3-benzothiazole |
| SMILES | Clc1ccc(-c2ccc(-c3nc4ccccc4s3)o2)c(Cl)c1 |
| InChI | InChI=1S/C17H9Cl2NOS/c18-10-5-6-11(12(19)9-10)14-7-8-15(21-14)17-20-13-3-1-2-4-16(13)22-17/h1-9H |
| InChIKey | SNTJQBLACVRTHF-UHFFFAOYSA-N |
| XLogP | 6.53 |
| TPSA | 26.03 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.24 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |