C25H16ClNS — CID 169291592
2-[3-[3-(3-chlorophenyl)phenyl]phenyl]-1,3-benzothiazole (PubChem CID 169291592) has the molecular formula C25H16ClNS and a molecular weight of 397.93 g/mol. Its IUPAC name is 2-[3-[3-(3-chlorophenyl)phenyl]phenyl]-1,3-benzothiazole.
| Compound Name | 2-[3-[3-(3-chlorophenyl)phenyl]phenyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 169291592 |
| Molecular Formula | C25H16ClNS |
| Molecular Weight | 397.93 g/mol |
| Exact Mass | 397.07 |
| IUPAC Name | 2-[3-[3-(3-chlorophenyl)phenyl]phenyl]-1,3-benzothiazole |
| SMILES | Clc1cccc(-c2cccc(-c3cccc(-c4nc5ccccc5s4)c3)c2)c1 |
| InChI | InChI=1S/C25H16ClNS/c26-22-11-5-9-20(16-22)18-7-3-6-17(14-18)19-8-4-10-21(15-19)25-27-23-12-1-2-13-24(23)28-25/h1-16H |
| InChIKey | BJAMTUMBKQHFCB-UHFFFAOYSA-N |
| XLogP | 7.95 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 397.93 |
| LogP ≤ 5 | 7.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |