C19H11BrClNS — CID 156550838
2-[3-(4-bromophenyl)-5-chlorophenyl]-1,3-benzothiazole (PubChem CID 156550838) has the molecular formula C19H11BrClNS and a molecular weight of 400.73 g/mol. Its IUPAC name is 2-[3-(4-bromophenyl)-5-chlorophenyl]-1,3-benzothiazole.
| Compound Name | 2-[3-(4-bromophenyl)-5-chlorophenyl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 156550838 |
| Molecular Formula | C19H11BrClNS |
| Molecular Weight | 400.73 g/mol |
| Exact Mass | 398.95 |
| IUPAC Name | 2-[3-(4-bromophenyl)-5-chlorophenyl]-1,3-benzothiazole |
| SMILES | Clc1cc(-c2ccc(Br)cc2)cc(-c2nc3ccccc3s2)c1 |
| InChI | InChI=1S/C19H11BrClNS/c20-15-7-5-12(6-8-15)13-9-14(11-16(21)10-13)19-22-17-3-1-2-4-18(17)23-19/h1-11H |
| InChIKey | XQBVGTHGMMWMCP-UHFFFAOYSA-N |
| XLogP | 7.05 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.73 |
| LogP ≤ 5 | 7.05 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |