C16H9Cl2N3S — CID 141131792
2-[3-(3,5-dichlorophenyl)-1H-pyrazol-5-yl]-1,3-benzothiazole (PubChem CID 141131792) has the molecular formula C16H9Cl2N3S and a molecular weight of 346.24 g/mol. Its IUPAC name is 2-[3-(3,5-dichlorophenyl)-1H-pyrazol-5-yl]-1,3-benzothiazole.
| Compound Name | 2-[3-(3,5-dichlorophenyl)-1H-pyrazol-5-yl]-1,3-benzothiazole |
|---|---|
| PubChem CID | 141131792 |
| Molecular Formula | C16H9Cl2N3S |
| Molecular Weight | 346.24 g/mol |
| Exact Mass | 344.99 |
| IUPAC Name | 2-[3-(3,5-dichlorophenyl)-1H-pyrazol-5-yl]-1,3-benzothiazole |
| SMILES | Clc1cc(Cl)cc(-c2cc(-c3nc4ccccc4s3)[nH]n2)c1 |
| InChI | InChI=1S/C16H9Cl2N3S/c17-10-5-9(6-11(18)7-10)13-8-14(21-20-13)16-19-12-3-1-2-4-15(12)22-16/h1-8H,(H,20,21) |
| InChIKey | UNBVXSQERRITND-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 41.57 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.24 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |