C23H15N3S — CID 58480092
2-(3,5-dipyridin-3-ylphenyl)-1,3-benzothiazole (PubChem CID 58480092) has the molecular formula C23H15N3S and a molecular weight of 365.46 g/mol. Its IUPAC name is 2-(3,5-dipyridin-3-ylphenyl)-1,3-benzothiazole.
| Compound Name | 2-(3,5-dipyridin-3-ylphenyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 58480092 |
| Molecular Formula | C23H15N3S |
| Molecular Weight | 365.46 g/mol |
| Exact Mass | 365.10 |
| IUPAC Name | 2-(3,5-dipyridin-3-ylphenyl)-1,3-benzothiazole |
| SMILES | c1cncc(-c2cc(-c3cccnc3)cc(-c3nc4ccccc4s3)c2)c1 |
| InChI | InChI=1S/C23H15N3S/c1-2-8-22-21(7-1)26-23(27-22)20-12-18(16-5-3-9-24-14-16)11-19(13-20)17-6-4-10-25-15-17/h1-15H |
| InChIKey | JCSPSBSJCKQERL-UHFFFAOYSA-N |
| XLogP | 6.09 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.46 |
| LogP ≤ 5 | 6.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |