C16H10N4S — CID 121378342
6-pyridin-2-yl-2-pyridin-3-yl-[1,3]thiazolo[4,5-c]pyridine (PubChem CID 121378342) has the molecular formula C16H10N4S and a molecular weight of 290.35 g/mol. Its IUPAC name is 6-pyridin-2-yl-2-pyridin-3-yl-[1,3]thiazolo[4,5-c]pyridine.
| Compound Name | 6-pyridin-2-yl-2-pyridin-3-yl-[1,3]thiazolo[4,5-c]pyridine |
|---|---|
| PubChem CID | 121378342 |
| Molecular Formula | C16H10N4S |
| Molecular Weight | 290.35 g/mol |
| Exact Mass | 290.06 |
| IUPAC Name | 6-pyridin-2-yl-2-pyridin-3-yl-[1,3]thiazolo[4,5-c]pyridine |
| SMILES | c1ccc(-c2cc3sc(-c4cccnc4)nc3cn2)nc1 |
| InChI | InChI=1S/C16H10N4S/c1-2-7-18-12(5-1)13-8-15-14(10-19-13)20-16(21-15)11-4-3-6-17-9-11/h1-10H |
| InChIKey | NGEKUUACWKUTAT-UHFFFAOYSA-N |
| XLogP | 3.82 |
| TPSA | 51.56 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.35 |
| LogP ≤ 5 | 3.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |