C18H22N2OSSi — CID 151333152
tert-butyl-dimethyl-[(2-pyridin-3-yl-1,3-benzothiazol-6-yl)oxy]silane (PubChem CID 151333152) has the molecular formula C18H22N2OSSi and a molecular weight of 342.54 g/mol. Its IUPAC name is tert-butyl-dimethyl-[(2-pyridin-3-yl-1,3-benzothiazol-6-yl)oxy]silane.
| Compound Name | tert-butyl-dimethyl-[(2-pyridin-3-yl-1,3-benzothiazol-6-yl)oxy]silane |
|---|---|
| PubChem CID | 151333152 |
| Molecular Formula | C18H22N2OSSi |
| Molecular Weight | 342.54 g/mol |
| Exact Mass | 342.12 |
| IUPAC Name | tert-butyl-dimethyl-[(2-pyridin-3-yl-1,3-benzothiazol-6-yl)oxy]silane |
| SMILES | CC(C)(C)[Si](C)(C)Oc1ccc2nc(-c3cccnc3)sc2c1 |
| InChI | InChI=1S/C18H22N2OSSi/c1-18(2,3)23(4,5)21-14-8-9-15-16(11-14)22-17(20-15)13-7-6-10-19-12-13/h6-12H,1-5H3 |
| InChIKey | OIWRBGXDWJASLD-UHFFFAOYSA-N |
| XLogP | 5.74 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 342.54 |
| LogP ≤ 5 | 5.74 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|