C20H16N2S2 — CID 125469311
6-(3-ethylsulfanylphenyl)-2-pyridin-3-yl-1,3-benzothiazole (PubChem CID 125469311) has the molecular formula C20H16N2S2 and a molecular weight of 348.50 g/mol. Its IUPAC name is 6-(3-ethylsulfanylphenyl)-2-pyridin-3-yl-1,3-benzothiazole.
| Compound Name | 6-(3-ethylsulfanylphenyl)-2-pyridin-3-yl-1,3-benzothiazole |
|---|---|
| PubChem CID | 125469311 |
| Molecular Formula | C20H16N2S2 |
| Molecular Weight | 348.50 g/mol |
| Exact Mass | 348.08 |
| IUPAC Name | 6-(3-ethylsulfanylphenyl)-2-pyridin-3-yl-1,3-benzothiazole |
| SMILES | CCSc1cccc(-c2ccc3nc(-c4cccnc4)sc3c2)c1 |
| InChI | InChI=1S/C20H16N2S2/c1-2-23-17-7-3-5-14(11-17)15-8-9-18-19(12-15)24-20(22-18)16-6-4-10-21-13-16/h3-13H,2H2,1H3 |
| InChIKey | HPYSOFKCCWYBIC-UHFFFAOYSA-N |
| XLogP | 6.14 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.50 |
| LogP ≤ 5 | 6.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |