C46H36N2S — CID 145437093
4,6-bis[3-(4-ethylphenyl)phenyl]-2-(4-pyridin-3-ylphenyl)-1,3-benzothiazole (PubChem CID 145437093) has the molecular formula C46H36N2S and a molecular weight of 648.88 g/mol. Its IUPAC name is 4,6-bis[3-(4-ethylphenyl)phenyl]-2-(4-pyridin-3-ylphenyl)-1,3-benzothiazole.
| Compound Name | 4,6-bis[3-(4-ethylphenyl)phenyl]-2-(4-pyridin-3-ylphenyl)-1,3-benzothiazole |
|---|---|
| PubChem CID | 145437093 |
| Molecular Formula | C46H36N2S |
| Molecular Weight | 648.88 g/mol |
| Exact Mass | 648.26 |
| IUPAC Name | 4,6-bis[3-(4-ethylphenyl)phenyl]-2-(4-pyridin-3-ylphenyl)-1,3-benzothiazole |
| SMILES | CCc1ccc(-c2cccc(-c3cc(-c4cccc(-c5ccc(CC)cc5)c4)c4nc(-c5ccc(-c6cccnc6)cc5)sc4c3)c2)cc1 |
| InChI | InChI=1S/C46H36N2S/c1-3-31-13-17-33(18-14-31)37-8-5-10-39(26-37)42-28-43(40-11-6-9-38(27-40)34-19-15-32(4-2)16-20-34)45-44(29-42)49-46(48-45)36-23-21-35(22-24-36)41-12-7-25-47-30-41/h5-30H,3-4H2,1-2H3 |
| InChIKey | XRYKHQZKAWXTPC-UHFFFAOYSA-N |
| XLogP | 12.82 |
| TPSA | 25.78 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 648.88 |
| LogP ≤ 5 | 12.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |