C33H23N3 — CID 58518535
4-(3,5-dipyridin-3-ylphenyl)-2,6-diphenylpyridine (PubChem CID 58518535) has the molecular formula C33H23N3 and a molecular weight of 461.57 g/mol. Its IUPAC name is 4-(3,5-dipyridin-3-ylphenyl)-2,6-diphenylpyridine.
| Compound Name | 4-(3,5-dipyridin-3-ylphenyl)-2,6-diphenylpyridine |
|---|---|
| PubChem CID | 58518535 |
| Molecular Formula | C33H23N3 |
| Molecular Weight | 461.57 g/mol |
| Exact Mass | 461.19 |
| IUPAC Name | 4-(3,5-dipyridin-3-ylphenyl)-2,6-diphenylpyridine |
| SMILES | c1ccc(-c2cc(-c3cc(-c4cccnc4)cc(-c4cccnc4)c3)cc(-c3ccccc3)n2)cc1 |
| InChI | InChI=1S/C33H23N3/c1-3-9-24(10-4-1)32-20-31(21-33(36-32)25-11-5-2-6-12-25)30-18-28(26-13-7-15-34-22-26)17-29(19-30)27-14-8-16-35-23-27/h1-23H |
| InChIKey | UUYCHMKPWPPJKF-UHFFFAOYSA-N |
| XLogP | 8.21 |
| TPSA | 38.67 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 461.57 |
| LogP ≤ 5 | 8.21 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |