C20H17ClN4S — CID 6868146
N-[(E)-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-1,3-benzothiazol-2-amine (PubChem CID 6868146) has the molecular formula C20H17ClN4S and a molecular weight of 380.90 g/mol. Its IUPAC name is N-[(E)-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-1,3-benzothiazol-2-amine.
| Compound Name | N-[(E)-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 6868146 |
| Molecular Formula | C20H17ClN4S |
| Molecular Weight | 380.90 g/mol |
| Exact Mass | 380.09 |
| IUPAC Name | N-[(E)-[1-(4-chlorophenyl)-2,5-dimethylpyrrol-3-yl]methylideneamino]-1,3-benzothiazol-2-amine |
| SMILES | Cc1cc(/C=N/Nc2nc3ccccc3s2)c(C)n1-c1ccc(Cl)cc1 |
| InChI | InChI=1S/C20H17ClN4S/c1-13-11-15(14(2)25(13)17-9-7-16(21)8-10-17)12-22-24-20-23-18-5-3-4-6-19(18)26-20/h3-12H,1-2H3,(H,23,24)/b22-12+ |
| InChIKey | FCNPMQHWCMAXPZ-WSDLNYQXSA-N |
| XLogP | 5.80 |
| TPSA | 42.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 380.90 |
| LogP ≤ 5 | 5.80 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'pyrrole_A(118)', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|