C16H15N3S — CID 9017119
N-[(Z)-(2,4-dimethylphenyl)methylideneamino]-1,3-benzothiazol-2-amine (PubChem CID 9017119) has the molecular formula C16H15N3S and a molecular weight of 281.38 g/mol. Its IUPAC name is N-[(Z)-(2,4-dimethylphenyl)methylideneamino]-1,3-benzothiazol-2-amine.
| Compound Name | N-[(Z)-(2,4-dimethylphenyl)methylideneamino]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 9017119 |
| Molecular Formula | C16H15N3S |
| Molecular Weight | 281.38 g/mol |
| Exact Mass | 281.10 |
| IUPAC Name | N-[(Z)-(2,4-dimethylphenyl)methylideneamino]-1,3-benzothiazol-2-amine |
| SMILES | Cc1ccc(/C=N\Nc2nc3ccccc3s2)c(C)c1 |
| InChI | InChI=1S/C16H15N3S/c1-11-7-8-13(12(2)9-11)10-17-19-16-18-14-5-3-4-6-15(14)20-16/h3-10H,1-2H3,(H,18,19)/b17-10- |
| InChIKey | IDATVAZVBZLXPT-YVLHZVERSA-N |
| XLogP | 4.36 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.38 |
| LogP ≤ 5 | 4.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|