C18H17N3 — CID 29250260
N-[(Z)-(2,4-dimethylphenyl)methylideneamino]quinolin-2-amine (PubChem CID 29250260) has the molecular formula C18H17N3 and a molecular weight of 275.36 g/mol. Its IUPAC name is N-[(Z)-(2,4-dimethylphenyl)methylideneamino]quinolin-2-amine.
| Compound Name | N-[(Z)-(2,4-dimethylphenyl)methylideneamino]quinolin-2-amine |
|---|---|
| PubChem CID | 29250260 |
| Molecular Formula | C18H17N3 |
| Molecular Weight | 275.36 g/mol |
| Exact Mass | 275.14 |
| IUPAC Name | N-[(Z)-(2,4-dimethylphenyl)methylideneamino]quinolin-2-amine |
| SMILES | Cc1ccc(/C=N\Nc2ccc3ccccc3n2)c(C)c1 |
| InChI | InChI=1S/C18H17N3/c1-13-7-8-16(14(2)11-13)12-19-21-18-10-9-15-5-3-4-6-17(15)20-18/h3-12H,1-2H3,(H,20,21)/b19-12- |
| InChIKey | JEBOYDHIUAHHFL-UNOMPAQXSA-N |
| XLogP | 4.30 |
| TPSA | 37.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.36 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|