C16H13N3O3 — CID 3407357
4-[(quinolin-2-ylhydrazinylidene)methyl]benzene-1,2,3-triol (PubChem CID 3407357) has the molecular formula C16H13N3O3 and a molecular weight of 295.30 g/mol. Its IUPAC name is 4-[(quinolin-2-ylhydrazinylidene)methyl]benzene-1,2,3-triol.
| Compound Name | 4-[(quinolin-2-ylhydrazinylidene)methyl]benzene-1,2,3-triol |
|---|---|
| PubChem CID | 3407357 |
| Molecular Formula | C16H13N3O3 |
| Molecular Weight | 295.30 g/mol |
| Exact Mass | 295.10 |
| IUPAC Name | 4-[(quinolin-2-ylhydrazinylidene)methyl]benzene-1,2,3-triol |
| SMILES | Oc1ccc(C=NNc2ccc3ccccc3n2)c(O)c1O |
| InChI | InChI=1S/C16H13N3O3/c20-13-7-5-11(15(21)16(13)22)9-17-19-14-8-6-10-3-1-2-4-12(10)18-14/h1-9,20-22H,(H,18,19) |
| InChIKey | MUZGSMNTZJCHIE-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 97.97 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.30 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|