C17H14N2O3 — CID 3350036
4-[(naphthalen-2-ylhydrazinylidene)methyl]benzene-1,2,3-triol (PubChem CID 3350036) has the molecular formula C17H14N2O3 and a molecular weight of 294.31 g/mol. Its IUPAC name is 4-[(naphthalen-2-ylhydrazinylidene)methyl]benzene-1,2,3-triol.
| Compound Name | 4-[(naphthalen-2-ylhydrazinylidene)methyl]benzene-1,2,3-triol |
|---|---|
| PubChem CID | 3350036 |
| Molecular Formula | C17H14N2O3 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.10 |
| IUPAC Name | 4-[(naphthalen-2-ylhydrazinylidene)methyl]benzene-1,2,3-triol |
| SMILES | Oc1ccc(C=NNc2ccc3ccccc3c2)c(O)c1O |
| InChI | InChI=1S/C17H14N2O3/c20-15-8-6-13(16(21)17(15)22)10-18-19-14-7-5-11-3-1-2-4-12(11)9-14/h1-10,19-22H |
| InChIKey | ZVURFQGFGFSPCM-UHFFFAOYSA-N |
| XLogP | 3.40 |
| TPSA | 85.08 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 3.40 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hzone_phenol_A(479)', 'substructure': 'N/A'}, {'alert_name': 'hzone_phenol_B(215)', 'substructure': 'N/A'}, {'alert_name': 'catechol_A(92)', 'substructure': 'N/A'}, {'alert_name': 'catechol', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'} |
|---|