C9H8N2OS2 — CID 141289258
S-(1,3-benzothiazol-2-yl) 2-aminoethanethioate (PubChem CID 141289258) has the molecular formula C9H8N2OS2 and a molecular weight of 224.31 g/mol. Its IUPAC name is S-(1,3-benzothiazol-2-yl) 2-aminoethanethioate.
| Compound Name | S-(1,3-benzothiazol-2-yl) 2-aminoethanethioate |
|---|---|
| PubChem CID | 141289258 |
| Molecular Formula | C9H8N2OS2 |
| Molecular Weight | 224.31 g/mol |
| Exact Mass | 224.01 |
| IUPAC Name | S-(1,3-benzothiazol-2-yl) 2-aminoethanethioate |
| SMILES | NCC(=O)Sc1nc2ccccc2s1 |
| InChI | InChI=1S/C9H8N2OS2/c10-5-8(12)14-9-11-6-3-1-2-4-7(6)13-9/h1-4H,5,10H2 |
| InChIKey | GRTLGANDSJDYJD-UHFFFAOYSA-N |
| XLogP | 1.87 |
| TPSA | 55.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 224.31 |
| LogP ≤ 5 | 1.87 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thioester', 'substructure': 'N/A'} |
|---|