C11H11N3O2S2 — CID 70410957
2-(1,3-benzothiazol-2-ylsulfanyl)butanediamide (PubChem CID 70410957) has the molecular formula C11H11N3O2S2 and a molecular weight of 281.36 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylsulfanyl)butanediamide.
| Compound Name | 2-(1,3-benzothiazol-2-ylsulfanyl)butanediamide |
|---|---|
| PubChem CID | 70410957 |
| Molecular Formula | C11H11N3O2S2 |
| Molecular Weight | 281.36 g/mol |
| Exact Mass | 281.03 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylsulfanyl)butanediamide |
| SMILES | NC(=O)CC(Sc1nc2ccccc2s1)C(N)=O |
| InChI | InChI=1S/C11H11N3O2S2/c12-9(15)5-8(10(13)16)18-11-14-6-3-1-2-4-7(6)17-11/h1-4,8H,5H2,(H2,12,15)(H2,13,16) |
| InChIKey | QQBKPMYTTNCKCV-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 99.07 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.36 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |