C18H15NO4S2 — CID 18966887
2-[1,3-benzothiazol-2-ylsulfanyl(phenyl)methyl]butanedioic acid (PubChem CID 18966887) has the molecular formula C18H15NO4S2 and a molecular weight of 373.46 g/mol. Its IUPAC name is 2-[1,3-benzothiazol-2-ylsulfanyl(phenyl)methyl]butanedioic acid.
| Compound Name | 2-[1,3-benzothiazol-2-ylsulfanyl(phenyl)methyl]butanedioic acid |
|---|---|
| PubChem CID | 18966887 |
| Molecular Formula | C18H15NO4S2 |
| Molecular Weight | 373.46 g/mol |
| Exact Mass | 373.04 |
| IUPAC Name | 2-[1,3-benzothiazol-2-ylsulfanyl(phenyl)methyl]butanedioic acid |
| SMILES | O=C(O)CC(C(=O)O)C(Sc1nc2ccccc2s1)c1ccccc1 |
| InChI | InChI=1S/C18H15NO4S2/c20-15(21)10-12(17(22)23)16(11-6-2-1-3-7-11)25-18-19-13-8-4-5-9-14(13)24-18/h1-9,12,16H,10H2,(H,20,21)(H,22,23) |
| InChIKey | BWGVTCQRFLTMEW-UHFFFAOYSA-N |
| XLogP | 4.31 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.46 |
| LogP ≤ 5 | 4.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |