C12H9NO4S2 — CID 19966573
2-(1,3-benzothiazole-2-carbothioyl)butanedioic acid (PubChem CID 19966573) has the molecular formula C12H9NO4S2 and a molecular weight of 295.34 g/mol. Its IUPAC name is 2-(1,3-benzothiazole-2-carbothioyl)butanedioic acid.
| Compound Name | 2-(1,3-benzothiazole-2-carbothioyl)butanedioic acid |
|---|---|
| PubChem CID | 19966573 |
| Molecular Formula | C12H9NO4S2 |
| Molecular Weight | 295.34 g/mol |
| Exact Mass | 295.00 |
| IUPAC Name | 2-(1,3-benzothiazole-2-carbothioyl)butanedioic acid |
| SMILES | O=C(O)CC(C(=O)O)C(=S)c1nc2ccccc2s1 |
| InChI | InChI=1S/C12H9NO4S2/c14-9(15)5-6(12(16)17)10(18)11-13-7-3-1-2-4-8(7)19-11/h1-4,6H,5H2,(H,14,15)(H,16,17) |
| InChIKey | LEXSFKZESQMHJD-UHFFFAOYSA-N |
| XLogP | 2.19 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 295.34 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'thio_ketone(43)', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|