C12H10ClNO4S2 — CID 19772405
2-(1,3-benzothiazol-2-ylsulfanyl)-3-(chloromethyl)butanedioic acid (PubChem CID 19772405) has the molecular formula C12H10ClNO4S2 and a molecular weight of 331.80 g/mol. Its IUPAC name is 2-(1,3-benzothiazol-2-ylsulfanyl)-3-(chloromethyl)butanedioic acid.
| Compound Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-3-(chloromethyl)butanedioic acid |
|---|---|
| PubChem CID | 19772405 |
| Molecular Formula | C12H10ClNO4S2 |
| Molecular Weight | 331.80 g/mol |
| Exact Mass | 330.97 |
| IUPAC Name | 2-(1,3-benzothiazol-2-ylsulfanyl)-3-(chloromethyl)butanedioic acid |
| SMILES | O=C(O)C(CCl)C(Sc1nc2ccccc2s1)C(=O)O |
| InChI | InChI=1S/C12H10ClNO4S2/c13-5-6(10(15)16)9(11(17)18)20-12-14-7-3-1-2-4-8(7)19-12/h1-4,6,9H,5H2,(H,15,16)(H,17,18) |
| InChIKey | BAEVCILZDSGAEE-UHFFFAOYSA-N |
| XLogP | 2.78 |
| TPSA | 87.49 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 331.80 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|