C9H5ClF3NS2 — CID 73427431
2-(1-chloro-2,2,2-trifluoroethyl)sulfanyl-1,3-benzothiazole (PubChem CID 73427431) has the molecular formula C9H5ClF3NS2 and a molecular weight of 283.73 g/mol. Its IUPAC name is 2-(1-chloro-2,2,2-trifluoroethyl)sulfanyl-1,3-benzothiazole.
| Compound Name | 2-(1-chloro-2,2,2-trifluoroethyl)sulfanyl-1,3-benzothiazole |
|---|---|
| PubChem CID | 73427431 |
| Molecular Formula | C9H5ClF3NS2 |
| Molecular Weight | 283.73 g/mol |
| Exact Mass | 282.95 |
| IUPAC Name | 2-(1-chloro-2,2,2-trifluoroethyl)sulfanyl-1,3-benzothiazole |
| SMILES | FC(F)(F)C(Cl)Sc1nc2ccccc2s1 |
| InChI | InChI=1S/C9H5ClF3NS2/c10-7(9(11,12)13)16-8-14-5-3-1-2-4-6(5)15-8/h1-4,7H |
| InChIKey | VKLSNBPDAYGHSL-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.73 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|